C14H19Cl3N2O4 — CID 170245301
2,2,2-trichloroethyl (1R,2S,3R,4S)-3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 170245301) has the molecular formula C14H19Cl3N2O4 and a molecular weight of 385.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (1R,2S,3R,4S)-3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (1R,2S,3R,4S)-3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 170245301 |
| Molecular Formula | C14H19Cl3N2O4 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2,2,2-trichloroethyl (1R,2S,3R,4S)-3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)[C@H]1[C@@H](C(=O)N2CCNCC2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C14H19Cl3N2O4/c15-14(16,17)7-22-13(21)11-9-2-1-8(23-9)10(11)12(20)19-5-3-18-4-6-19/h8-11,18H,1-7H2/t8-,9+,10-,11+/m0/s1 |
| InChIKey | BJFLZRZTTOYRGB-ZRUFSTJUSA-N |
| XLogP | 1.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|