C8H10Cl3N5O2 — CID 19707093
2,2,2-trichloroethyl 1-(2H-tetrazol-5-yl)pyrrolidine-2-carboxylate (PubChem CID 19707093) has the molecular formula C8H10Cl3N5O2 and a molecular weight of 314.56 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-(2H-tetrazol-5-yl)pyrrolidine-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-(2H-tetrazol-5-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 19707093 |
| Molecular Formula | C8H10Cl3N5O2 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2,2,2-trichloroethyl 1-(2H-tetrazol-5-yl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)C1CCCN1c1nn[nH]n1 |
| InChI | InChI=1S/C8H10Cl3N5O2/c9-8(10,11)4-18-6(17)5-2-1-3-16(5)7-12-14-15-13-7/h5H,1-4H2,(H,12,13,14,15) |
| InChIKey | ZJONVQPGWQULJL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|