C22H37NO5 — CID 170246328
6-[4-(3,3-dimethyl-2-oxobutyl)-4-(3-methyl-2-oxobutyl)piperidin-1-yl]-6-oxohexanoic acid (PubChem CID 170246328) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is 6-[4-(3,3-dimethyl-2-oxobutyl)-4-(3-methyl-2-oxobutyl)piperidin-1-yl]-6-oxohexanoic acid.
| Compound Name | 6-[4-(3,3-dimethyl-2-oxobutyl)-4-(3-methyl-2-oxobutyl)piperidin-1-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 170246328 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 6-[4-(3,3-dimethyl-2-oxobutyl)-4-(3-methyl-2-oxobutyl)piperidin-1-yl]-6-oxohexanoic acid |
| SMILES | CC(C)C(=O)CC1(CC(=O)C(C)(C)C)CCN(C(=O)CCCCC(=O)O)CC1 |
| InChI | InChI=1S/C22H37NO5/c1-16(2)17(24)14-22(15-18(25)21(3,4)5)10-12-23(13-11-22)19(26)8-6-7-9-20(27)28/h16H,6-15H2,1-5H3,(H,27,28) |
| InChIKey | QCQXVOZRXZCAOY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|