About 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride
5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride (PubChem CID 17024794) has the molecular formula C8H8ClN3O3S
and a molecular weight of 261.69 g/mol. Its IUPAC name is 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride.
Analyze 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride?
The IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride (CID 17024794) is 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride.
What is the SMILES notation for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride?
The canonical SMILES for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride is Cc1nn(C)cc1-c1oncc1S(=O)(=O)Cl.
What is the InChIKey of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride?
The InChIKey is ABJPLTWVTQPJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O3S/c1-5-6(4-12(2)11-5)8-7(3-10-15-8)16(9,13)14/h3-4H,1-2H3.
What are the key properties of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride?
5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride has a molecular weight of 261.69 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-4-sulfonyl chloride is sourced from PubChem (CID 17024794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).