About 2-bromo-5-pentylpyridine
2-bromo-5-pentylpyridine (PubChem CID 170248675) has the molecular formula C10H14BrN
and a molecular weight of 228.13 g/mol. Its IUPAC name is 2-bromo-5-pentylpyridine.
Molecular Properties
| Compound Name | 2-bromo-5-pentylpyridine |
| PubChem CID | 170248675 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-bromo-5-pentylpyridine |
| SMILES | CCCCCc1ccc(Br)nc1 |
| InChI | InChI=1S/C10H14BrN/c1-2-3-4-5-9-6-7-10(11)12-8-9/h6-8H,2-5H2,1H3 |
| InChIKey | RZWPZECTXZVTSY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-pentylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-pentylpyridine?
The IUPAC name of 2-bromo-5-pentylpyridine (CID 170248675) is 2-bromo-5-pentylpyridine.
What is the SMILES notation for 2-bromo-5-pentylpyridine?
The canonical SMILES for 2-bromo-5-pentylpyridine is CCCCCc1ccc(Br)nc1.
What is the InChIKey of 2-bromo-5-pentylpyridine?
The InChIKey is RZWPZECTXZVTSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN/c1-2-3-4-5-9-6-7-10(11)12-8-9/h6-8H,2-5H2,1H3.
What are the key properties of 2-bromo-5-pentylpyridine?
2-bromo-5-pentylpyridine has a molecular weight of 228.13 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-pentylpyridine is sourced from PubChem (CID 170248675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).