C25H20ClF3N4O2 — CID 170250250
N-[5-(7-chlorospiro[3,4-dihydro-2H-1-benzazepine-5,2'-aziridine]-1-carbonyl)-2-pyridinyl]-2-(trifluoromethyl)benzamide (PubChem CID 170250250) has the molecular formula C25H20ClF3N4O2 and a molecular weight of 500.91 g/mol. Its IUPAC name is N-[5-(7-chlorospiro[3,4-dihydro-2H-1-benzazepine-5,2'-aziridine]-1-carbonyl)-2-pyridinyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[5-(7-chlorospiro[3,4-dihydro-2H-1-benzazepine-5,2'-aziridine]-1-carbonyl)-2-pyridinyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170250250 |
| Molecular Formula | C25H20ClF3N4O2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | N-[5-(7-chlorospiro[3,4-dihydro-2H-1-benzazepine-5,2'-aziridine]-1-carbonyl)-2-pyridinyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCC3(CN3)c3cc(Cl)ccc32)cn1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H20ClF3N4O2/c26-16-7-8-20-19(12-16)24(14-31-24)10-3-11-33(20)23(35)15-6-9-21(30-13-15)32-22(34)17-4-1-2-5-18(17)25(27,28)29/h1-2,4-9,12-13,31H,3,10-11,14H2,(H,30,32,34) |
| InChIKey | OZCHLPRSQOCDNI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|