C33H42N10O2 — CID 170251790
(Z)-4-[6-[[1-cyclopropyl-4-[4-(dimethylamino)piperidin-1-yl]indol-6-yl]amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-imino-N-propan-2-ylbut-2-enamide (PubChem CID 170251790) has the molecular formula C33H42N10O2 and a molecular weight of 610.77 g/mol. Its IUPAC name is (Z)-4-[6-[[1-cyclopropyl-4-[4-(dimethylamino)piperidin-1-yl]indol-6-yl]amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-imino-N-propan-2-ylbut-2-enamide.
| Compound Name | (Z)-4-[6-[[1-cyclopropyl-4-[4-(dimethylamino)piperidin-1-yl]indol-6-yl]amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-imino-N-propan-2-ylbut-2-enamide |
|---|---|
| PubChem CID | 170251790 |
| Molecular Formula | C33H42N10O2 |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | (Z)-4-[6-[[1-cyclopropyl-4-[4-(dimethylamino)piperidin-1-yl]indol-6-yl]amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-imino-N-propan-2-ylbut-2-enamide |
| SMILES | [H]/N=C(/C=C\C(=O)NC(C)C)n1c2nc(Nc3cc(N4CCC(N(C)C)CC4)c4ccn(C5CC5)c4c3)ncc2c(=O)n1CC=C |
| InChI | InChI=1S/C33H42N10O2/c1-6-14-42-32(45)26-20-35-33(38-31(26)43(42)29(34)9-10-30(44)36-21(2)3)37-22-18-27(40-15-11-23(12-16-40)39(4)5)25-13-17-41(24-7-8-24)28(25)19-22/h6,9-10,13,17-21,23-24,34H,1,7-8,11-12,14-16H2,2-5H3,(H,36,44)(H,35,37,38)/b10-9-,34-29- |
| InChIKey | JUDLKIMRCRQMRJ-NGCGYXDISA-N |
| XLogP | 4.25 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|