C32H37N5O4 — CID 170251975
(2E)-N-[(3S)-5-methyl-4-oxo-7-[4-(pyridin-2-ylmethoxy)butyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-(3-phenylprop-1-en-2-ylhydrazinylidene)propanamide (PubChem CID 170251975) has the molecular formula C32H37N5O4 and a molecular weight of 555.68 g/mol. Its IUPAC name is (2E)-N-[(3S)-5-methyl-4-oxo-7-[4-(pyridin-2-ylmethoxy)butyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-(3-phenylprop-1-en-2-ylhydrazinylidene)propanamide.
| Compound Name | (2E)-N-[(3S)-5-methyl-4-oxo-7-[4-(pyridin-2-ylmethoxy)butyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-(3-phenylprop-1-en-2-ylhydrazinylidene)propanamide |
|---|---|
| PubChem CID | 170251975 |
| Molecular Formula | C32H37N5O4 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | (2E)-N-[(3S)-5-methyl-4-oxo-7-[4-(pyridin-2-ylmethoxy)butyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-(3-phenylprop-1-en-2-ylhydrazinylidene)propanamide |
| SMILES | C=C(Cc1ccccc1)N/N=C(\C)C(=O)N[C@H]1COc2ccc(CCCCOCc3ccccn3)cc2N(C)C1=O |
| InChI | InChI=1S/C32H37N5O4/c1-23(19-25-11-5-4-6-12-25)35-36-24(2)31(38)34-28-22-41-30-16-15-26(20-29(30)37(3)32(28)39)13-8-10-18-40-21-27-14-7-9-17-33-27/h4-7,9,11-12,14-17,20,28,35H,1,8,10,13,18-19,21-22H2,2-3H3,(H,34,38)/b36-24+/t28-/m0/s1 |
| InChIKey | NZVQBIWKEVEGHE-CBMBWPLASA-N |
| XLogP | 4.18 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|