C21H24N2O3 — CID 170252392
(4-phenylpiperidin-4-yl) 2-(2,6-dimethylanilino)-2-oxoacetate (PubChem CID 170252392) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-(2,6-dimethylanilino)-2-oxoacetate.
| Compound Name | (4-phenylpiperidin-4-yl) 2-(2,6-dimethylanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 170252392 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-(2,6-dimethylanilino)-2-oxoacetate |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C21H24N2O3/c1-15-7-6-8-16(2)18(15)23-19(24)20(25)26-21(11-13-22-14-12-21)17-9-4-3-5-10-17/h3-10,22H,11-14H2,1-2H3,(H,23,24) |
| InChIKey | KLEWPMWQBIOSGO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|