C7H10ClN3O — CID 170256746
3-chloro-1-ethyl-N-methylpyrazole-4-carboxamide (PubChem CID 170256746) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is 3-chloro-1-ethyl-N-methylpyrazole-4-carboxamide.
| Compound Name | 3-chloro-1-ethyl-N-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170256746 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 3-chloro-1-ethyl-N-methylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)NC)c(Cl)n1 |
| InChI | InChI=1S/C7H10ClN3O/c1-3-11-4-5(6(8)10-11)7(12)9-2/h4H,3H2,1-2H3,(H,9,12) |
| InChIKey | GVGHMBRFWSJVBA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |