About 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol
2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol (PubChem CID 170260348) has the molecular formula C10H8F3N5O
and a molecular weight of 271.20 g/mol. Its IUPAC name is 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol.
Molecular Properties
| Compound Name | 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol |
| PubChem CID | 170260348 |
| Molecular Formula | C10H8F3N5O |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol |
| SMILES | Cc1nc(N)nnc1-c1ncc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C10H8F3N5O/c1-4-7(17-18-9(14)16-4)8-6(19)2-5(3-15-8)10(11,12)13/h2-3,19H,1H3,(H2,14,16,18) |
| InChIKey | ILGBBDRAOHGADR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol?
The IUPAC name of 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol (CID 170260348) is 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol.
What is the SMILES notation for 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol?
The canonical SMILES for 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol is Cc1nc(N)nnc1-c1ncc(C(F)(F)F)cc1O.
What is the InChIKey of 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol?
The InChIKey is ILGBBDRAOHGADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N5O/c1-4-7(17-18-9(14)16-4)8-6(19)2-5(3-15-8)10(11,12)13/h2-3,19H,1H3,(H2,14,16,18).
What are the key properties of 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol?
2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol has a molecular weight of 271.20 g/mol, XLogP of 1.55, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-5-methyl-1,2,4-triazin-6-yl)-5-(trifluoromethyl)pyridin-3-ol is sourced from PubChem (CID 170260348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).