C22H31N5O3 — CID 170260589
2-[3-[[6-[2,4-dimethyl-6-(propoxymethoxy)phenyl]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]acetaldehyde (PubChem CID 170260589) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[3-[[6-[2,4-dimethyl-6-(propoxymethoxy)phenyl]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]acetaldehyde.
| Compound Name | 2-[3-[[6-[2,4-dimethyl-6-(propoxymethoxy)phenyl]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 170260589 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-[3-[[6-[2,4-dimethyl-6-(propoxymethoxy)phenyl]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]acetaldehyde |
| SMILES | CCCOCOc1cc(C)cc(C)c1-c1cnc(NC2CCCN(CC=O)C2)nn1 |
| InChI | InChI=1S/C22H31N5O3/c1-4-10-29-15-30-20-12-16(2)11-17(3)21(20)19-13-23-22(26-25-19)24-18-6-5-7-27(14-18)8-9-28/h9,11-13,18H,4-8,10,14-15H2,1-3H3,(H,23,24,26) |
| InChIKey | FJMCLOGCRCYZFN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|