C28H38O12 — CID 170262726
1,9-dimethyl-7-propan-2-yl-8-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethenoxy]-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one (PubChem CID 170262726) has the molecular formula C28H38O12 and a molecular weight of 566.60 g/mol. Its IUPAC name is 1,9-dimethyl-7-propan-2-yl-8-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethenoxy]-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one.
| Compound Name | 1,9-dimethyl-7-propan-2-yl-8-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethenoxy]-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one |
|---|---|
| PubChem CID | 170262726 |
| Molecular Formula | C28H38O12 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 1,9-dimethyl-7-propan-2-yl-8-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethenoxy]-3,6,10,15-tetraoxahexacyclo[10.7.0.02,4.02,9.05,7.013,17]nonadec-13(17)-en-16-one |
| SMILES | CC(C)C12OC1C1OC13C1(C)CCC4=C(COC4=O)C1COC3(C)C2OC=COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C28H38O12/c1-12(2)27-20(39-27)21-28(40-21)25(3)6-5-13-14(10-36-22(13)33)15(25)11-37-26(28,4)24(27)35-8-7-34-23-19(32)18(31)17(30)16(9-29)38-23/h7-8,12,15-21,23-24,29-32H,5-6,9-11H2,1-4H3 |
| InChIKey | YCZQYHPVHVMXGE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|