C9H19O2S- — CID 170263481
2,4,5-trimethylhexane-2-sulfinate (PubChem CID 170263481) has the molecular formula C9H19O2S- and a molecular weight of 191.32 g/mol. Its IUPAC name is 2,4,5-trimethylhexane-2-sulfinate.
| Compound Name | 2,4,5-trimethylhexane-2-sulfinate |
|---|---|
| PubChem CID | 170263481 |
| Molecular Formula | C9H19O2S- |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2,4,5-trimethylhexane-2-sulfinate |
| SMILES | CC(C)C(C)CC(C)(C)S(=O)[O-] |
| InChI | InChI=1S/C9H20O2S/c1-7(2)8(3)6-9(4,5)12(10)11/h7-8H,6H2,1-5H3,(H,10,11)/p-1 |
| InChIKey | UPGCEKZXKSTKIK-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|