C6H12N2O3S2 — CID 170265422
2-[(1-amino-2-oxopropyl)disulfanyl]-2-(methylamino)acetic acid (PubChem CID 170265422) has the molecular formula C6H12N2O3S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-[(1-amino-2-oxopropyl)disulfanyl]-2-(methylamino)acetic acid.
| Compound Name | 2-[(1-amino-2-oxopropyl)disulfanyl]-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 170265422 |
| Molecular Formula | C6H12N2O3S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-[(1-amino-2-oxopropyl)disulfanyl]-2-(methylamino)acetic acid |
| SMILES | CNC(SSC(N)C(C)=O)C(=O)O |
| InChI | InChI=1S/C6H12N2O3S2/c1-3(9)4(7)12-13-5(8-2)6(10)11/h4-5,8H,7H2,1-2H3,(H,10,11) |
| InChIKey | XYTUVGISRFRKCT-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|