C15H12N2O — CID 170265485
3-(3-methylimidazo[1,5-a]pyridin-6-yl)benzaldehyde (PubChem CID 170265485) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-(3-methylimidazo[1,5-a]pyridin-6-yl)benzaldehyde.
| Compound Name | 3-(3-methylimidazo[1,5-a]pyridin-6-yl)benzaldehyde |
|---|---|
| PubChem CID | 170265485 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3-(3-methylimidazo[1,5-a]pyridin-6-yl)benzaldehyde |
| SMILES | Cc1ncc2ccc(-c3cccc(C=O)c3)cn12 |
| InChI | InChI=1S/C15H12N2O/c1-11-16-8-15-6-5-14(9-17(11)15)13-4-2-3-12(7-13)10-18/h2-10H,1H3 |
| InChIKey | MGAAXQJKRRUUEV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|