C15H24N2 — CID 170268958
(3Z)-3-ethylidene-5-(3-iminopropyl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine (PubChem CID 170268958) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (3Z)-3-ethylidene-5-(3-iminopropyl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine.
| Compound Name | (3Z)-3-ethylidene-5-(3-iminopropyl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 170268958 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (3Z)-3-ethylidene-5-(3-iminopropyl)-2,4,4,6-tetramethylcyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C/CCC1=C(C)C(N)=C(C)/C(=C\C)C1(C)C |
| InChI | InChI=1S/C15H24N2/c1-6-12-10(2)14(17)11(3)13(8-7-9-16)15(12,4)5/h6,9,16H,7-8,17H2,1-5H3/b12-6+,16-9+ |
| InChIKey | GDAZKEMOSZKPMK-BKUNKUCPSA-N |
| XLogP | 3.95 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|