C26H20S — CID 170269188
7-methyl-8-[(Z)-prop-1-enyl]-5,10-bis(prop-1-ynyl)naphtho[2,3-f][1]benzothiole (PubChem CID 170269188) has the molecular formula C26H20S and a molecular weight of 364.51 g/mol. Its IUPAC name is 7-methyl-8-[(Z)-prop-1-enyl]-5,10-bis(prop-1-ynyl)naphtho[2,3-f][1]benzothiole.
| Compound Name | 7-methyl-8-[(Z)-prop-1-enyl]-5,10-bis(prop-1-ynyl)naphtho[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 170269188 |
| Molecular Formula | C26H20S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 7-methyl-8-[(Z)-prop-1-enyl]-5,10-bis(prop-1-ynyl)naphtho[2,3-f][1]benzothiole |
| SMILES | CC#Cc1c2cc(C)c(/C=C\C)cc2c(C#CC)c2cc3sccc3cc12 |
| InChI | InChI=1S/C26H20S/c1-5-8-18-14-23-21(10-7-3)25-16-26-19(11-12-27-26)15-24(25)20(9-6-2)22(23)13-17(18)4/h5,8,11-16H,1-4H3/b8-5- |
| InChIKey | PHQWMSWPRQSKBV-YVMONPNESA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|