C22H25N5O5 — CID 170269610
3-[5-[[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]methyl]-4-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170269610) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 3-[5-[[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]methyl]-4-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]methyl]-4-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170269610 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-[5-[[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)amino]methyl]-4-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CNc4nnc(C5CCCCC5)o4)c(O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H25N5O5/c28-16-9-8-15(19(30)24-16)27-11-14-7-6-13(18(29)17(14)21(27)31)10-23-22-26-25-20(32-22)12-4-2-1-3-5-12/h6-7,12,15,29H,1-5,8-11H2,(H,23,26)(H,24,28,30) |
| InChIKey | SABURPCRQYGFFT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|