C23H28N4O2S — CID 170274125
N-[2-(1-methylindol-3-yl)-2-[methyl(propyl)amino]ethyl]-1H-indole-6-sulfonamide (PubChem CID 170274125) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[2-(1-methylindol-3-yl)-2-[methyl(propyl)amino]ethyl]-1H-indole-6-sulfonamide.
| Compound Name | N-[2-(1-methylindol-3-yl)-2-[methyl(propyl)amino]ethyl]-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 170274125 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[2-(1-methylindol-3-yl)-2-[methyl(propyl)amino]ethyl]-1H-indole-6-sulfonamide |
| SMILES | CCCN(C)C(CNS(=O)(=O)c1ccc2cc[nH]c2c1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C23H28N4O2S/c1-4-13-26(2)23(20-16-27(3)22-8-6-5-7-19(20)22)15-25-30(28,29)18-10-9-17-11-12-24-21(17)14-18/h5-12,14,16,23-25H,4,13,15H2,1-3H3 |
| InChIKey | UZTTXMOYAXQIBO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |