C21H22N4O2S — CID 167001344
N-[2-(dimethylamino)-2-quinolin-8-ylethyl]-1H-indole-6-sulfonamide (PubChem CID 167001344) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-quinolin-8-ylethyl]-1H-indole-6-sulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-quinolin-8-ylethyl]-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 167001344 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[2-(dimethylamino)-2-quinolin-8-ylethyl]-1H-indole-6-sulfonamide |
| SMILES | CN(C)C(CNS(=O)(=O)c1ccc2cc[nH]c2c1)c1cccc2cccnc12 |
| InChI | InChI=1S/C21H22N4O2S/c1-25(2)20(18-7-3-5-16-6-4-11-23-21(16)18)14-24-28(26,27)17-9-8-15-10-12-22-19(15)13-17/h3-13,20,22,24H,14H2,1-2H3 |
| InChIKey | YGKBFAJTEBKCIY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |