C20H22N4O2S — CID 162743480
N-[2-(methylamino)-2-(1-methylindol-3-yl)ethyl]-1H-indole-6-sulfonamide (PubChem CID 162743480) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[2-(methylamino)-2-(1-methylindol-3-yl)ethyl]-1H-indole-6-sulfonamide.
| Compound Name | N-[2-(methylamino)-2-(1-methylindol-3-yl)ethyl]-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 162743480 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[2-(methylamino)-2-(1-methylindol-3-yl)ethyl]-1H-indole-6-sulfonamide |
| SMILES | CNC(CNS(=O)(=O)c1ccc2cc[nH]c2c1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C20H22N4O2S/c1-21-19(17-13-24(2)20-6-4-3-5-16(17)20)12-23-27(25,26)15-8-7-14-9-10-22-18(14)11-15/h3-11,13,19,21-23H,12H2,1-2H3 |
| InChIKey | TUIGYKBXKPRSHP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |