About 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole
4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 170274895) has the molecular formula C22H12N6S3
and a molecular weight of 456.58 g/mol. Its IUPAC name is 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole |
| PubChem CID | 170274895 |
| Molecular Formula | C22H12N6S3 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | c1ncc(-c2ccc(-c3ccc(-c4ccc(-c5cncnc5)s4)c4nsnc34)s2)cn1 |
| InChI | InChI=1S/C22H12N6S3/c1-2-16(20-6-4-18(30-20)14-9-25-12-26-10-14)22-21(27-31-28-22)15(1)19-5-3-17(29-19)13-7-23-11-24-8-13/h1-12H |
| InChIKey | YNZBEDQMTYNRBO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole?
The IUPAC name of 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole (CID 170274895) is 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole.
What is the SMILES notation for 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole?
The canonical SMILES for 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole is c1ncc(-c2ccc(-c3ccc(-c4ccc(-c5cncnc5)s4)c4nsnc34)s2)cn1.
What is the InChIKey of 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole?
The InChIKey is YNZBEDQMTYNRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N6S3/c1-2-16(20-6-4-18(30-20)14-9-25-12-26-10-14)22-21(27-31-28-22)15(1)19-5-3-17(29-19)13-7-23-11-24-8-13/h1-12H.
What are the key properties of 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole?
4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole has a molecular weight of 456.58 g/mol, XLogP of 6.06, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole is sourced from PubChem (CID 170274895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).