C22H12N6S3 — CID 170274895
4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 170274895) has the molecular formula C22H12N6S3 and a molecular weight of 456.58 g/mol. Its IUPAC name is 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 170274895 |
| Molecular Formula | C22H12N6S3 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 4,7-bis(5-pyrimidin-5-ylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | c1ncc(-c2ccc(-c3ccc(-c4ccc(-c5cncnc5)s4)c4nsnc34)s2)cn1 |
| InChI | InChI=1S/C22H12N6S3/c1-2-16(20-6-4-18(30-20)14-9-25-12-26-10-14)22-21(27-31-28-22)15(1)19-5-3-17(29-19)13-7-23-11-24-8-13/h1-12H |
| InChIKey | YNZBEDQMTYNRBO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |