C40H12F10S4 — CID 170275021
7-fluoro-2-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(7-fluoro-[1]benzothiolo[6,5-f][1]benzothiol-2-yl)phenyl]phenyl]-[1]benzothiolo[6,5-f][1]benzothiole (PubChem CID 170275021) has the molecular formula C40H12F10S4 and a molecular weight of 810.78 g/mol. Its IUPAC name is 7-fluoro-2-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(7-fluoro-[1]benzothiolo[6,5-f][1]benzothiol-2-yl)phenyl]phenyl]-[1]benzothiolo[6,5-f][1]benzothiole.
| Compound Name | 7-fluoro-2-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(7-fluoro-[1]benzothiolo[6,5-f][1]benzothiol-2-yl)phenyl]phenyl]-[1]benzothiolo[6,5-f][1]benzothiole |
|---|---|
| PubChem CID | 170275021 |
| Molecular Formula | C40H12F10S4 |
| Molecular Weight | 810.78 g/mol |
| Exact Mass | 809.97 |
| IUPAC Name | 7-fluoro-2-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(7-fluoro-[1]benzothiolo[6,5-f][1]benzothiol-2-yl)phenyl]phenyl]-[1]benzothiolo[6,5-f][1]benzothiole |
| SMILES | Fc1cc2cc3cc4sc(-c5c(F)c(F)c(-c6c(F)c(F)c(-c7cc8cc9cc%10sc(F)cc%10cc9cc8s7)c(F)c6F)c(F)c5F)cc4cc3cc2s1 |
| InChI | InChI=1S/C40H12F10S4/c41-27-11-19-3-15-5-21-17(1-13(15)7-23(19)53-27)9-25(51-21)29-33(43)37(47)31(38(48)34(29)44)32-39(49)35(45)30(36(46)40(32)50)26-10-18-2-14-8-24-20(12-28(42)54-24)4-16(14)6-22(18)52-26/h1-12H |
| InChIKey | VEFZFACYNISQQU-UHFFFAOYSA-N |
| XLogP | 15.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.78 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|