C43H30O5 — CID 170278920
4-[(Z)-cyclohexa-2,4-dien-1-ylidene-[2-(1-naphtho[2,3-b][1]benzofuran-2-ylethenyl)phenyl]methyl]-6-phenylbenzene-1,2,3,5-tetrol (PubChem CID 170278920) has the molecular formula C43H30O5 and a molecular weight of 626.71 g/mol. Its IUPAC name is 4-[(Z)-cyclohexa-2,4-dien-1-ylidene-[2-(1-naphtho[2,3-b][1]benzofuran-2-ylethenyl)phenyl]methyl]-6-phenylbenzene-1,2,3,5-tetrol.
| Compound Name | 4-[(Z)-cyclohexa-2,4-dien-1-ylidene-[2-(1-naphtho[2,3-b][1]benzofuran-2-ylethenyl)phenyl]methyl]-6-phenylbenzene-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 170278920 |
| Molecular Formula | C43H30O5 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | 4-[(Z)-cyclohexa-2,4-dien-1-ylidene-[2-(1-naphtho[2,3-b][1]benzofuran-2-ylethenyl)phenyl]methyl]-6-phenylbenzene-1,2,3,5-tetrol |
| SMILES | C=C(c1ccc2oc3cc4ccccc4cc3c2c1)c1ccccc1/C(=C1/C=CC=CC1)c1c(O)c(O)c(O)c(-c2ccccc2)c1O |
| InChI | InChI=1S/C43H30O5/c1-25(28-20-21-35-33(22-28)34-23-29-16-8-9-17-30(29)24-36(34)48-35)31-18-10-11-19-32(31)37(26-12-4-2-5-13-26)39-40(44)38(27-14-6-3-7-15-27)41(45)43(47)42(39)46/h2-12,14-24,44-47H,1,13H2/b37-26+ |
| InChIKey | USBZNXVUPDQZNW-AVLPFNLUSA-N |
| XLogP | 10.61 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|