C51H40B2O12 — CID 174139230
CID 174139230 (PubChem CID 174139230) has the molecular formula C51H40B2O12 and a molecular weight of 866.49 g/mol.
| Compound Name | CID 174139230 |
|---|---|
| PubChem CID | 174139230 |
| Molecular Formula | C51H40B2O12 |
| Molecular Weight | 866.49 g/mol |
| Exact Mass | 866.27 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)c(O)c(-c2ccc3cc4oc5ccc(/C(=C6\C=CC=CC6)c6ccccc6C(C)(C)C(=C)/C(O)=C(O)\C(O)=C(\O)Cc6c(O)cc(O)c([B])c6O)cc5c4cc3c2)c(O)c1O |
| InChI | InChI=1S/C51H40B2O12/c1-23(43(57)50(64)45(59)36(56)21-32-34(54)22-35(55)41(52)44(32)58)51(2,3)33-12-8-7-11-29(33)39(24-9-5-4-6-10-24)27-15-16-37-30(18-27)31-19-28-17-26(14-13-25(28)20-38(31)65-37)40-46(60)48(62)42(53)49(63)47(40)61/h4-9,11-20,22,54-64H,1,10,21H2,2-3H3/b39-24-,45-36-,50-43- |
| InChIKey | AJRFXUORPIBJSK-NHMGELMHSA-N |
| XLogP | 8.98 |
| TPSA | 235.67 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.49 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|