C10H12N2O — CID 170279766
4-methoxy-1,5-dimethylindazole (PubChem CID 170279766) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-methoxy-1,5-dimethylindazole.
| Compound Name | 4-methoxy-1,5-dimethylindazole |
|---|---|
| PubChem CID | 170279766 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-methoxy-1,5-dimethylindazole |
| SMILES | COc1c(C)ccc2c1cnn2C |
| InChI | InChI=1S/C10H12N2O/c1-7-4-5-9-8(10(7)13-3)6-11-12(9)2/h4-6H,1-3H3 |
| InChIKey | DVSHNLZMANPBRS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |