About 4-methoxy-1,5-dimethylindazole
4-methoxy-1,5-dimethylindazole (PubChem CID 170279766) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-methoxy-1,5-dimethylindazole.
Molecular Properties
| Compound Name | 4-methoxy-1,5-dimethylindazole |
| PubChem CID | 170279766 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-methoxy-1,5-dimethylindazole |
| SMILES | COc1c(C)ccc2c1cnn2C |
| InChI | InChI=1S/C10H12N2O/c1-7-4-5-9-8(10(7)13-3)6-11-12(9)2/h4-6H,1-3H3 |
| InChIKey | DVSHNLZMANPBRS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-1,5-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,5-dimethylindazole?
The IUPAC name of 4-methoxy-1,5-dimethylindazole (CID 170279766) is 4-methoxy-1,5-dimethylindazole.
What is the SMILES notation for 4-methoxy-1,5-dimethylindazole?
The canonical SMILES for 4-methoxy-1,5-dimethylindazole is COc1c(C)ccc2c1cnn2C.
What is the InChIKey of 4-methoxy-1,5-dimethylindazole?
The InChIKey is DVSHNLZMANPBRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-7-4-5-9-8(10(7)13-3)6-11-12(9)2/h4-6H,1-3H3.
What are the key properties of 4-methoxy-1,5-dimethylindazole?
4-methoxy-1,5-dimethylindazole has a molecular weight of 176.22 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,5-dimethylindazole is sourced from PubChem (CID 170279766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).