C11H14N2 — CID 176690635
4-ethyl-1,5-dimethylindazole (PubChem CID 176690635) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-ethyl-1,5-dimethylindazole.
| Compound Name | 4-ethyl-1,5-dimethylindazole |
|---|---|
| PubChem CID | 176690635 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4-ethyl-1,5-dimethylindazole |
| SMILES | CCc1c(C)ccc2c1cnn2C |
| InChI | InChI=1S/C11H14N2/c1-4-9-8(2)5-6-11-10(9)7-12-13(11)3/h5-7H,4H2,1-3H3 |
| InChIKey | JKZKNICMLCPYIW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |