About 4-ethyl-1,5-dimethylindazole
4-ethyl-1,5-dimethylindazole (PubChem CID 176690635) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-ethyl-1,5-dimethylindazole.
Molecular Properties
| Compound Name | 4-ethyl-1,5-dimethylindazole |
| PubChem CID | 176690635 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4-ethyl-1,5-dimethylindazole |
| SMILES | CCc1c(C)ccc2c1cnn2C |
| InChI | InChI=1S/C11H14N2/c1-4-9-8(2)5-6-11-10(9)7-12-13(11)3/h5-7H,4H2,1-3H3 |
| InChIKey | JKZKNICMLCPYIW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,5-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,5-dimethylindazole?
The IUPAC name of 4-ethyl-1,5-dimethylindazole (CID 176690635) is 4-ethyl-1,5-dimethylindazole.
What is the SMILES notation for 4-ethyl-1,5-dimethylindazole?
The canonical SMILES for 4-ethyl-1,5-dimethylindazole is CCc1c(C)ccc2c1cnn2C.
What is the InChIKey of 4-ethyl-1,5-dimethylindazole?
The InChIKey is JKZKNICMLCPYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-4-9-8(2)5-6-11-10(9)7-12-13(11)3/h5-7H,4H2,1-3H3.
What are the key properties of 4-ethyl-1,5-dimethylindazole?
4-ethyl-1,5-dimethylindazole has a molecular weight of 174.25 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,5-dimethylindazole is sourced from PubChem (CID 176690635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).