C10H12N2O — CID 155733013
(1,7-dimethylindazol-4-yl)methanol (PubChem CID 155733013) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (1,7-dimethylindazol-4-yl)methanol.
| Compound Name | (1,7-dimethylindazol-4-yl)methanol |
|---|---|
| PubChem CID | 155733013 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (1,7-dimethylindazol-4-yl)methanol |
| SMILES | Cc1ccc(CO)c2cnn(C)c12 |
| InChI | InChI=1S/C10H12N2O/c1-7-3-4-8(6-13)9-5-11-12(2)10(7)9/h3-5,13H,6H2,1-2H3 |
| InChIKey | BUMDIGTWGRQEIK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |