C13H20ClN3O2 — CID 145080487
4-chloro-1,7-dimethylindazole;ethane;2-hydroxyacetamide (PubChem CID 145080487) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-chloro-1,7-dimethylindazole;ethane;2-hydroxyacetamide.
| Compound Name | 4-chloro-1,7-dimethylindazole;ethane;2-hydroxyacetamide |
|---|---|
| PubChem CID | 145080487 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-chloro-1,7-dimethylindazole;ethane;2-hydroxyacetamide |
| SMILES | CC.Cc1ccc(Cl)c2cnn(C)c12.NC(=O)CO |
| InChI | InChI=1S/C9H9ClN2.C2H5NO2.C2H6/c1-6-3-4-8(10)7-5-11-12(2)9(6)7;3-2(5)1-4;1-2/h3-5H,1-2H3;4H,1H2,(H2,3,5);1-2H3 |
| InChIKey | OQINCJYCTNGTQK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |