C21H43N — CID 170289549
(E)-N-(2,2-dimethylpropyl)-2,2,5,5,9,9-hexamethyldec-6-en-1-amine (PubChem CID 170289549) has the molecular formula C21H43N and a molecular weight of 309.58 g/mol. Its IUPAC name is (E)-N-(2,2-dimethylpropyl)-2,2,5,5,9,9-hexamethyldec-6-en-1-amine.
| Compound Name | (E)-N-(2,2-dimethylpropyl)-2,2,5,5,9,9-hexamethyldec-6-en-1-amine |
|---|---|
| PubChem CID | 170289549 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | (E)-N-(2,2-dimethylpropyl)-2,2,5,5,9,9-hexamethyldec-6-en-1-amine |
| SMILES | CC(C)(C)C/C=C/C(C)(C)CCC(C)(C)CNCC(C)(C)C |
| InChI | InChI=1S/C21H43N/c1-18(2,3)12-11-13-20(7,8)14-15-21(9,10)17-22-16-19(4,5)6/h11,13,22H,12,14-17H2,1-10H3/b13-11+ |
| InChIKey | UVPFLQNMIIQMRV-ACCUITESSA-N |
| XLogP | 6.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|