C25H46N2 — CID 167385062
(E)-N'-[(E)-4,4-dimethylpent-1-enyl]-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]prop-1-ene-1,3-diamine (PubChem CID 167385062) has the molecular formula C25H46N2 and a molecular weight of 374.66 g/mol. Its IUPAC name is (E)-N'-[(E)-4,4-dimethylpent-1-enyl]-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]prop-1-ene-1,3-diamine.
| Compound Name | (E)-N'-[(E)-4,4-dimethylpent-1-enyl]-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167385062 |
| Molecular Formula | C25H46N2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.37 |
| IUPAC Name | (E)-N'-[(E)-4,4-dimethylpent-1-enyl]-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]prop-1-ene-1,3-diamine |
| SMILES | CC/C=C/C(C)(C)CCC(C)(C)/C=C/CN/C=C/CN/C=C/CC(C)(C)C |
| InChI | InChI=1S/C25H46N2/c1-9-10-15-24(5,6)17-18-25(7,8)16-12-20-27-22-13-21-26-19-11-14-23(2,3)4/h10-13,15-16,19,22,26-27H,9,14,17-18,20-21H2,1-8H3/b15-10+,16-12+,19-11+,22-13+ |
| InChIKey | SOKWLGHQJXUWGE-XPMOHYHLSA-N |
| XLogP | 6.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|