C26H19N2P — CID 170290623
[4-[7-(6-pyridin-2-yl-3-pyridinyl)naphthalen-2-yl]phenyl]phosphane (PubChem CID 170290623) has the molecular formula C26H19N2P and a molecular weight of 390.43 g/mol. Its IUPAC name is [4-[7-(6-pyridin-2-yl-3-pyridinyl)naphthalen-2-yl]phenyl]phosphane.
| Compound Name | [4-[7-(6-pyridin-2-yl-3-pyridinyl)naphthalen-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 170290623 |
| Molecular Formula | C26H19N2P |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [4-[7-(6-pyridin-2-yl-3-pyridinyl)naphthalen-2-yl]phenyl]phosphane |
| SMILES | Pc1ccc(-c2ccc3ccc(-c4ccc(-c5ccccn5)nc4)cc3c2)cc1 |
| InChI | InChI=1S/C26H19N2P/c29-24-11-8-18(9-12-24)20-6-4-19-5-7-21(16-23(19)15-20)22-10-13-26(28-17-22)25-3-1-2-14-27-25/h1-17H,29H2 |
| InChIKey | MTXVCJYAGOTULM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|