C36H69N3O8S2 — CID 170298842
3-methylbutyl 7-[[4-[2-[4-[2-(disulfanyl)ethyl]piperazin-1-yl]ethoxy]-4-oxobutyl]-[2-hydroxy-7-(3-methylbutoxy)-7-oxoheptyl]amino]-6-hydroxyheptanoate (PubChem CID 170298842) has the molecular formula C36H69N3O8S2 and a molecular weight of 736.09 g/mol. Its IUPAC name is 3-methylbutyl 7-[[4-[2-[4-[2-(disulfanyl)ethyl]piperazin-1-yl]ethoxy]-4-oxobutyl]-[2-hydroxy-7-(3-methylbutoxy)-7-oxoheptyl]amino]-6-hydroxyheptanoate.
| Compound Name | 3-methylbutyl 7-[[4-[2-[4-[2-(disulfanyl)ethyl]piperazin-1-yl]ethoxy]-4-oxobutyl]-[2-hydroxy-7-(3-methylbutoxy)-7-oxoheptyl]amino]-6-hydroxyheptanoate |
|---|---|
| PubChem CID | 170298842 |
| Molecular Formula | C36H69N3O8S2 |
| Molecular Weight | 736.09 g/mol |
| Exact Mass | 735.45 |
| IUPAC Name | 3-methylbutyl 7-[[4-[2-[4-[2-(disulfanyl)ethyl]piperazin-1-yl]ethoxy]-4-oxobutyl]-[2-hydroxy-7-(3-methylbutoxy)-7-oxoheptyl]amino]-6-hydroxyheptanoate |
| SMILES | CC(C)CCOC(=O)CCCCC(O)CN(CCCC(=O)OCCN1CCN(CCSS)CC1)CC(O)CCCCC(=O)OCCC(C)C |
| InChI | InChI=1S/C36H69N3O8S2/c1-30(2)15-24-45-34(42)12-7-5-10-32(40)28-39(29-33(41)11-6-8-13-35(43)46-25-16-31(3)4)17-9-14-36(44)47-26-22-37-18-20-38(21-19-37)23-27-49-48/h30-33,40-41,48H,5-29H2,1-4H3 |
| InChIKey | IEZYQOJQVVOHHA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.09 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|