C22H26N4O3 — CID 17030610
N-[2-[1-[2-(cyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide (PubChem CID 17030610) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[2-[1-[2-(cyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[1-[2-(cyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17030610 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-[2-[1-[2-(cyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
| SMILES | O=C(Cn1c(CCNC(=O)c2ccco2)nc2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C22H26N4O3/c27-21(24-16-7-2-1-3-8-16)15-26-18-10-5-4-9-17(18)25-20(26)12-13-23-22(28)19-11-6-14-29-19/h4-6,9-11,14,16H,1-3,7-8,12-13,15H2,(H,23,28)(H,24,27) |
| InChIKey | SSXCORHVRMBXJM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |