C34H50F2N6O5S — CID 170308122
7-[5-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-3-(oxan-4-yl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]heptyl ethanesulfonate (PubChem CID 170308122) has the molecular formula C34H50F2N6O5S and a molecular weight of 692.87 g/mol. Its IUPAC name is 7-[5-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-3-(oxan-4-yl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]heptyl ethanesulfonate.
| Compound Name | 7-[5-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-3-(oxan-4-yl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]heptyl ethanesulfonate |
|---|---|
| PubChem CID | 170308122 |
| Molecular Formula | C34H50F2N6O5S |
| Molecular Weight | 692.87 g/mol |
| Exact Mass | 692.35 |
| IUPAC Name | 7-[5-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-3-(oxan-4-yl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]heptyl ethanesulfonate |
| SMILES | CCS(=O)(=O)OCCCCCCCN1C(=O)N(C2CCOCC2)Cc2c(NC(C)c3cccc(C(F)(F)C4CCNCC4)c3)ncnc21 |
| InChI | InChI=1S/C34H50F2N6O5S/c1-3-48(44,45)47-19-8-6-4-5-7-18-41-32-30(23-42(33(41)43)29-14-20-46-21-15-29)31(38-24-39-32)40-25(2)26-10-9-11-28(22-26)34(35,36)27-12-16-37-17-13-27/h9-11,22,24-25,27,29,37H,3-8,12-21,23H2,1-2H3,(H,38,39,40) |
| InChIKey | DWPYEHURRGVYRT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.87 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|