C23H26N4O4 — CID 17031031
N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]propanamide (PubChem CID 17031031) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]propanamide.
| Compound Name | N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]propanamide |
|---|---|
| PubChem CID | 17031031 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]propanamide |
| SMILES | CCC(=O)NCCCc1nc2ccccc2n1CC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H26N4O4/c1-2-22(28)24-11-5-8-21-26-17-6-3-4-7-18(17)27(21)15-23(29)25-16-9-10-19-20(14-16)31-13-12-30-19/h3-4,6-7,9-10,14H,2,5,8,11-13,15H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | LRRRLIOCELJFQO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|