C27H32N4O4 — CID 17031374
N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide (PubChem CID 17031374) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17031374 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-[3-[1-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide |
| SMILES | O=C(Cn1c(CCCNC(=O)C2CCCCC2)nc2ccccc21)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C27H32N4O4/c32-26(29-20-12-13-23-24(17-20)35-16-15-34-23)18-31-22-10-5-4-9-21(22)30-25(31)11-6-14-28-27(33)19-7-2-1-3-8-19/h4-5,9-10,12-13,17,19H,1-3,6-8,11,14-16,18H2,(H,28,33)(H,29,32) |
| InChIKey | OKUZOMJDEBLKAQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|