C25H29FN4O2 — CID 17031356
N-[3-[1-[2-(3-fluoroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide (PubChem CID 17031356) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[3-[1-[2-(3-fluoroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[1-[2-(3-fluoroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17031356 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-[3-[1-[2-(3-fluoroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]cyclohexanecarboxamide |
| SMILES | O=C(Cn1c(CCCNC(=O)C2CCCCC2)nc2ccccc21)Nc1cccc(F)c1 |
| InChI | InChI=1S/C25H29FN4O2/c26-19-10-6-11-20(16-19)28-24(31)17-30-22-13-5-4-12-21(22)29-23(30)14-7-15-27-25(32)18-8-2-1-3-9-18/h4-6,10-13,16,18H,1-3,7-9,14-15,17H2,(H,27,32)(H,28,31) |
| InChIKey | AZUZQIMQRNNTNX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|