C19H27N6O7P — CID 170315403
[(2S,3S,4R,5R)-5-(6-amino-4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid (PubChem CID 170315403) has the molecular formula C19H27N6O7P and a molecular weight of 482.43 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(6-amino-4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid.
| Compound Name | [(2S,3S,4R,5R)-5-(6-amino-4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 170315403 |
| Molecular Formula | C19H27N6O7P |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(6-amino-4-oxo-5H-imidazo[4,5-c]pyridin-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid |
| SMILES | CCCCOC[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(N)cc32)O[C@@H]1COP(=O)(O)n1ccnc1 |
| InChI | InChI=1S/C19H27N6O7P/c1-2-3-6-30-8-12-14(9-31-33(28,29)24-5-4-21-10-24)32-19(17(12)26)25-11-22-16-13(25)7-15(20)23-18(16)27/h4-5,7,10-12,14,17,19,26H,2-3,6,8-9H2,1H3,(H,28,29)(H3,20,23,27)/t12-,14-,17-,19-/m1/s1 |
| InChIKey | GORQKZKRFZDIMG-KJMSJTNLSA-N |
| XLogP | 0.86 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|