C17H29N4O11P2+ — CID 170315399
[(2S,3S,4R,5R)-5-(6-amino-3-methyl-4-oxo-5H-imidazo[4,5-c]pyridin-3-ium-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 170315399) has the molecular formula C17H29N4O11P2+ and a molecular weight of 527.38 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(6-amino-3-methyl-4-oxo-5H-imidazo[4,5-c]pyridin-3-ium-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-5-(6-amino-3-methyl-4-oxo-5H-imidazo[4,5-c]pyridin-3-ium-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170315399 |
| Molecular Formula | C17H29N4O11P2+ |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(6-amino-3-methyl-4-oxo-5H-imidazo[4,5-c]pyridin-3-ium-1-yl)-3-(butoxymethyl)-4-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CCCCOC[C@H]1[C@@H](O)[C@H](n2c[n+](C)c3c(=O)[nH]c(N)cc32)O[C@@H]1COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C17H28N4O11P2/c1-3-4-5-29-7-10-12(8-30-34(27,28)32-33(24,25)26)31-17(15(10)22)21-9-20(2)14-11(21)6-13(18)19-16(14)23/h6,9-10,12,15,17,22H,3-5,7-8H2,1-2H3,(H5-,18,19,23,24,25,26,27,28)/p+1/t10-,12-,15-,17-/m1/s1 |
| InChIKey | YCDPCQORBXFPJO-HDXACZHMSA-O |
| XLogP | -0.35 |
| TPSA | 219.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|