C29H38O3 — CID 170320636
1-[3-(3-butoxyphenyl)-2-(methoxymethoxy)-5-methylphenyl]adamantane (PubChem CID 170320636) has the molecular formula C29H38O3 and a molecular weight of 434.62 g/mol. Its IUPAC name is 1-[3-(3-butoxyphenyl)-2-(methoxymethoxy)-5-methylphenyl]adamantane.
| Compound Name | 1-[3-(3-butoxyphenyl)-2-(methoxymethoxy)-5-methylphenyl]adamantane |
|---|---|
| PubChem CID | 170320636 |
| Molecular Formula | C29H38O3 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 1-[3-(3-butoxyphenyl)-2-(methoxymethoxy)-5-methylphenyl]adamantane |
| SMILES | CCCCOc1cccc(-c2cc(C)cc(C34CC5CC(CC(C5)C3)C4)c2OCOC)c1 |
| InChI | InChI=1S/C29H38O3/c1-4-5-9-31-25-8-6-7-24(15-25)26-10-20(2)11-27(28(26)32-19-30-3)29-16-21-12-22(17-29)14-23(13-21)18-29/h6-8,10-11,15,21-23H,4-5,9,12-14,16-19H2,1-3H3 |
| InChIKey | RHQRBYVJVBZZFP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|