C36H51BrO3 — CID 170320650
1-[3-(2-bromo-5-octoxyphenyl)-5-tert-butyl-2-(methoxymethoxy)phenyl]adamantane (PubChem CID 170320650) has the molecular formula C36H51BrO3 and a molecular weight of 611.70 g/mol. Its IUPAC name is 1-[3-(2-bromo-5-octoxyphenyl)-5-tert-butyl-2-(methoxymethoxy)phenyl]adamantane.
| Compound Name | 1-[3-(2-bromo-5-octoxyphenyl)-5-tert-butyl-2-(methoxymethoxy)phenyl]adamantane |
|---|---|
| PubChem CID | 170320650 |
| Molecular Formula | C36H51BrO3 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 1-[3-(2-bromo-5-octoxyphenyl)-5-tert-butyl-2-(methoxymethoxy)phenyl]adamantane |
| SMILES | CCCCCCCCOc1ccc(Br)c(-c2cc(C(C)(C)C)cc(C34CC5CC(CC(C5)C3)C4)c2OCOC)c1 |
| InChI | InChI=1S/C36H51BrO3/c1-6-7-8-9-10-11-14-39-29-12-13-33(37)30(20-29)31-18-28(35(2,3)4)19-32(34(31)40-24-38-5)36-21-25-15-26(22-36)17-27(16-25)23-36/h12-13,18-20,25-27H,6-11,14-17,21-24H2,1-5H3 |
| InChIKey | NXQBBFKMPZPTQH-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|