C18H23BrO3 — CID 170321436
(E)-4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]-3-methylbut-2-enoic acid (PubChem CID 170321436) has the molecular formula C18H23BrO3 and a molecular weight of 367.28 g/mol. Its IUPAC name is (E)-4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]-3-methylbut-2-enoic acid.
| Compound Name | (E)-4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 170321436 |
| Molecular Formula | C18H23BrO3 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (E)-4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]-3-methylbut-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)CC1CCC(Oc2cccc(Br)c2C)CC1 |
| InChI | InChI=1S/C18H23BrO3/c1-12(11-18(20)21)10-14-6-8-15(9-7-14)22-17-5-3-4-16(19)13(17)2/h3-5,11,14-15H,6-10H2,1-2H3,(H,20,21)/b12-11+ |
| InChIKey | MMSOYFHJHUJPAJ-VAWYXSNFSA-N |
| XLogP | 5.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|