C27H23N3O3 — CID 170321681
3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-ol (PubChem CID 170321681) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-ol.
| Compound Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-ol |
|---|---|
| PubChem CID | 170321681 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-ol |
| SMILES | Cn1nc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2ccc(O)cc21 |
| InChI | InChI=1S/C27H23N3O3/c1-30-24-16-21(31)12-13-22(24)26(29-30)23-14-15-25(32-17-19-8-4-2-5-9-19)28-27(23)33-18-20-10-6-3-7-11-20/h2-16,31H,17-18H2,1H3 |
| InChIKey | IDQZJJWTWMJPCM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |