C27H24N4O2 — CID 170321835
3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-amine (PubChem CID 170321835) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-amine.
| Compound Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-amine |
|---|---|
| PubChem CID | 170321835 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-amine |
| SMILES | Cn1nc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2ccc(N)cc21 |
| InChI | InChI=1S/C27H24N4O2/c1-31-24-16-21(28)12-13-22(24)26(30-31)23-14-15-25(32-17-19-8-4-2-5-9-19)29-27(23)33-18-20-10-6-3-7-11-20/h2-16H,17-18,28H2,1H3 |
| InChIKey | JZEFMUOMZTUMKX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|