C22H21BBrN3O2 — CID 177198275
CID 177198275 (PubChem CID 177198275) has the molecular formula C22H21BBrN3O2 and a molecular weight of 450.15 g/mol.
| Compound Name | CID 177198275 |
|---|---|
| PubChem CID | 177198275 |
| Molecular Formula | C22H21BBrN3O2 |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | — |
| SMILES | CC.[B]Oc1ccc(-c2nn(C)c3c(Br)cccc23)c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C20H15BBrN3O2.C2H6/c1-25-19-14(8-5-9-16(19)22)18(24-25)15-10-11-17(27-21)23-20(15)26-12-13-6-3-2-4-7-13;1-2/h2-11H,12H2,1H3;1-2H3 |
| InChIKey | JZYAEXQPKRZFDJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|