C27H21BrFN3O2 — CID 170322126
3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-6-bromo-7-fluoro-1-methylindazole (PubChem CID 170322126) has the molecular formula C27H21BrFN3O2 and a molecular weight of 518.39 g/mol. Its IUPAC name is 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-6-bromo-7-fluoro-1-methylindazole.
| Compound Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-6-bromo-7-fluoro-1-methylindazole |
|---|---|
| PubChem CID | 170322126 |
| Molecular Formula | C27H21BrFN3O2 |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-6-bromo-7-fluoro-1-methylindazole |
| SMILES | Cn1nc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2ccc(Br)c(F)c21 |
| InChI | InChI=1S/C27H21BrFN3O2/c1-32-26-20(12-14-22(28)24(26)29)25(31-32)21-13-15-23(33-16-18-8-4-2-5-9-18)30-27(21)34-17-19-10-6-3-7-11-19/h2-15H,16-17H2,1H3 |
| InChIKey | JLVJIIFGYKQPIW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |