C12H13ClN4O3S — CID 170322459
2-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfonylpropanamide (PubChem CID 170322459) has the molecular formula C12H13ClN4O3S and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfonylpropanamide.
| Compound Name | 2-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 170322459 |
| Molecular Formula | C12H13ClN4O3S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(N)=O)(c1cn(-c2cccnc2)nc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C12H13ClN4O3S/c1-12(11(14)18,21(2,19)20)9-7-17(16-10(9)13)8-4-3-5-15-6-8/h3-7H,1-2H3,(H2,14,18) |
| InChIKey | SUGRTNVAXPODFX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |