C13H17FN2O6S — CID 170341158
(2S)-2-amino-6-[(2-fluorosulfonyloxybenzoyl)amino]hexanoic acid (PubChem CID 170341158) has the molecular formula C13H17FN2O6S and a molecular weight of 348.35 g/mol. Its IUPAC name is (2S)-2-amino-6-[(2-fluorosulfonyloxybenzoyl)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(2-fluorosulfonyloxybenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 170341158 |
| Molecular Formula | C13H17FN2O6S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2S)-2-amino-6-[(2-fluorosulfonyloxybenzoyl)amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)c1ccccc1OS(=O)(=O)F)C(=O)O |
| InChI | InChI=1S/C13H17FN2O6S/c14-23(20,21)22-11-7-2-1-5-9(11)12(17)16-8-4-3-6-10(15)13(18)19/h1-2,5,7,10H,3-4,6,8,15H2,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | GONBFCURLLOTAN-JTQLQIEISA-N |
| XLogP | 0.59 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|